C18H24O3 — CID 46844681
(2R)-4-methyl-2-[(2R)-2-phenylmethoxypentyl]-2,3-dihydropyran-6-one (PubChem CID 46844681) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (2R)-4-methyl-2-[(2R)-2-phenylmethoxypentyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-4-methyl-2-[(2R)-2-phenylmethoxypentyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 46844681 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (2R)-4-methyl-2-[(2R)-2-phenylmethoxypentyl]-2,3-dihydropyran-6-one |
| SMILES | CCC[C@H](C[C@H]1CC(C)=CC(=O)O1)OCc1ccccc1 |
| InChI | InChI=1S/C18H24O3/c1-3-7-16(20-13-15-8-5-4-6-9-15)12-17-10-14(2)11-18(19)21-17/h4-6,8-9,11,16-17H,3,7,10,12-13H2,1-2H3/t16-,17-/m1/s1 |
| InChIKey | VYZZHNAHLMWYJB-IAGOWNOFSA-N |
| XLogP | 4.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |