C21H29NO4 — CID 20530950
4-(3-phenylmethoxyoctyl)-3,3a,6,6a-tetrahydrofuro[3,2-b]pyrrole-2,5-dione (PubChem CID 20530950) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-(3-phenylmethoxyoctyl)-3,3a,6,6a-tetrahydrofuro[3,2-b]pyrrole-2,5-dione.
| Compound Name | 4-(3-phenylmethoxyoctyl)-3,3a,6,6a-tetrahydrofuro[3,2-b]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 20530950 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-(3-phenylmethoxyoctyl)-3,3a,6,6a-tetrahydrofuro[3,2-b]pyrrole-2,5-dione |
| SMILES | CCCCCC(CCN1C(=O)CC2OC(=O)CC21)OCc1ccccc1 |
| InChI | InChI=1S/C21H29NO4/c1-2-3-5-10-17(25-15-16-8-6-4-7-9-16)11-12-22-18-13-21(24)26-19(18)14-20(22)23/h4,6-9,17-19H,2-3,5,10-15H2,1H3 |
| InChIKey | BPXMZOYCOXONSY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|