C21H30N2O3 — CID 22825827
(3aR,6aS)-3-(3-phenylmethoxyoctyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[d]imidazole-2,5-dione (PubChem CID 22825827) has the molecular formula C21H30N2O3 and a molecular weight of 358.48 g/mol. Its IUPAC name is (3aR,6aS)-3-(3-phenylmethoxyoctyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[d]imidazole-2,5-dione.
| Compound Name | (3aR,6aS)-3-(3-phenylmethoxyoctyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[d]imidazole-2,5-dione |
|---|---|
| PubChem CID | 22825827 |
| Molecular Formula | C21H30N2O3 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.23 |
| IUPAC Name | (3aR,6aS)-3-(3-phenylmethoxyoctyl)-3a,4,6,6a-tetrahydro-1H-cyclopenta[d]imidazole-2,5-dione |
| SMILES | CCCCCC(CCN1C(=O)N[C@H]2CC(=O)C[C@H]21)OCc1ccccc1 |
| InChI | InChI=1S/C21H30N2O3/c1-2-3-5-10-18(26-15-16-8-6-4-7-9-16)11-12-23-20-14-17(24)13-19(20)22-21(23)25/h4,6-9,18-20H,2-3,5,10-15H2,1H3,(H,22,25)/t18?,19-,20+/m0/s1 |
| InChIKey | SBEIMXDXNDJDRD-NRRUETGQSA-N |
| XLogP | 3.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|