C15H17IO — CID 102324958
(2R,4S,6S)-2-ethenyl-4-iodo-6-[(E)-2-phenylethenyl]oxane (PubChem CID 102324958) has the molecular formula C15H17IO and a molecular weight of 340.20 g/mol. Its IUPAC name is (2R,4S,6S)-2-ethenyl-4-iodo-6-[(E)-2-phenylethenyl]oxane.
| Compound Name | (2R,4S,6S)-2-ethenyl-4-iodo-6-[(E)-2-phenylethenyl]oxane |
|---|---|
| PubChem CID | 102324958 |
| Molecular Formula | C15H17IO |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (2R,4S,6S)-2-ethenyl-4-iodo-6-[(E)-2-phenylethenyl]oxane |
| SMILES | C=C[C@H]1C[C@H](I)C[C@@H](/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C15H17IO/c1-2-14-10-13(16)11-15(17-14)9-8-12-6-4-3-5-7-12/h2-9,13-15H,1,10-11H2/b9-8+/t13-,14-,15+/m0/s1 |
| InChIKey | UYZLAYILLUQYKP-UWUUIOHPSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|