C14H25NSi2 — CID 67654609
2-phenyl-N,N-bis(trimethylsilyl)ethenamine (PubChem CID 67654609) has the molecular formula C14H25NSi2 and a molecular weight of 263.53 g/mol. Its IUPAC name is 2-phenyl-N,N-bis(trimethylsilyl)ethenamine.
| Compound Name | 2-phenyl-N,N-bis(trimethylsilyl)ethenamine |
|---|---|
| PubChem CID | 67654609 |
| Molecular Formula | C14H25NSi2 |
| Molecular Weight | 263.53 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 2-phenyl-N,N-bis(trimethylsilyl)ethenamine |
| SMILES | C[Si](C)(C)N(C=Cc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C14H25NSi2/c1-16(2,3)15(17(4,5)6)13-12-14-10-8-7-9-11-14/h7-13H,1-6H3 |
| InChIKey | ZUCIEKYMHHDBOV-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|