C13H19NO2 — CID 102331412
2-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]ethanol (PubChem CID 102331412) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 2-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]ethanol.
| Compound Name | 2-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]ethanol |
|---|---|
| PubChem CID | 102331412 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 2-[(4S,5R)-3,4-dimethyl-5-phenyl-1,3-oxazolidin-2-yl]ethanol |
| SMILES | C[C@H]1[C@@H](c2ccccc2)OC(CCO)N1C |
| InChI | InChI=1S/C13H19NO2/c1-10-13(11-6-4-3-5-7-11)16-12(8-9-15)14(10)2/h3-7,10,12-13,15H,8-9H2,1-2H3/t10-,12?,13-/m0/s1 |
| InChIKey | GZCYPYBOUBTISG-VLIRHVTKSA-N |
| XLogP | 1.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |