C12H13FO2 — CID 166904690
2-(3-fluoro-2-prop-1-enylphenyl)-1,3-dioxolane (PubChem CID 166904690) has the molecular formula C12H13FO2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 2-(3-fluoro-2-prop-1-enylphenyl)-1,3-dioxolane.
| Compound Name | 2-(3-fluoro-2-prop-1-enylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 166904690 |
| Molecular Formula | C12H13FO2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 2-(3-fluoro-2-prop-1-enylphenyl)-1,3-dioxolane |
| SMILES | CC=Cc1c(F)cccc1C1OCCO1 |
| InChI | InChI=1S/C12H13FO2/c1-2-4-9-10(5-3-6-11(9)13)12-14-7-8-15-12/h2-6,12H,7-8H2,1H3 |
| InChIKey | FLQSFGJEDRYAAE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |