About CID 154243878
CID 154243878 (PubChem CID 154243878) has the molecular formula C7H3BCl4
and a molecular weight of 239.72 g/mol.
Molecular Properties
| Compound Name | CID 154243878 |
| PubChem CID | 154243878 |
| Molecular Formula | C7H3BCl4 |
| Molecular Weight | 239.72 g/mol |
| Exact Mass | 237.91 |
| IUPAC Name | — |
| SMILES | [B]c1c(Cl)c(Cl)c(C)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3BCl4/c1-2-4(9)6(11)3(8)7(12)5(2)10/h1H3 |
| InChIKey | YYYISJGARAKMRC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.72 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 154243878 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 154243878?
The IUPAC name of CID 154243878 (CID 154243878) is not available.
What is the SMILES notation for CID 154243878?
The canonical SMILES for CID 154243878 is [B]c1c(Cl)c(Cl)c(C)c(Cl)c1Cl.
What is the InChIKey of CID 154243878?
The InChIKey is YYYISJGARAKMRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BCl4/c1-2-4(9)6(11)3(8)7(12)5(2)10/h1H3.
What are the key properties of CID 154243878?
CID 154243878 has a molecular weight of 239.72 g/mol, XLogP of 3.40, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 154243878 is sourced from PubChem (CID 154243878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).