C6H2Cl6Pb — CID 174727181
1,2,3,4,5,6-hexachlorobenzene;λ2-plumbane (PubChem CID 174727181) has the molecular formula C6H2Cl6Pb and a molecular weight of 494.00 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachlorobenzene;λ2-plumbane.
| Compound Name | 1,2,3,4,5,6-hexachlorobenzene;λ2-plumbane |
|---|---|
| PubChem CID | 174727181 |
| Molecular Formula | C6H2Cl6Pb |
| Molecular Weight | 494.00 g/mol |
| Exact Mass | 491.81 |
| IUPAC Name | 1,2,3,4,5,6-hexachlorobenzene;λ2-plumbane |
| SMILES | Clc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl.[PbH2] |
| InChI | InChI=1S/C6Cl6.Pb.2H/c7-1-2(8)4(10)6(12)5(11)3(1)9;;; |
| InChIKey | GIAVIMBATQFZJS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.00 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|