C30Cl25Sb — CID 154700977
pentakis(2,3,4,5,6-pentachlorophenyl)-λ5-stibane (PubChem CID 154700977) has the molecular formula C30Cl25Sb and a molecular weight of 1368.41 g/mol. Its IUPAC name is pentakis(2,3,4,5,6-pentachlorophenyl)-λ5-stibane.
| Compound Name | pentakis(2,3,4,5,6-pentachlorophenyl)-λ5-stibane |
|---|---|
| PubChem CID | 154700977 |
| Molecular Formula | C30Cl25Sb |
| Molecular Weight | 1368.41 g/mol |
| Exact Mass | 1355.13 |
| IUPAC Name | pentakis(2,3,4,5,6-pentachlorophenyl)-λ5-stibane |
| SMILES | Clc1c(Cl)c(Cl)c([Sb](c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)(c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)(c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/5C6Cl5.Sb/c5*7-2-1-3(8)5(10)6(11)4(2)9; |
| InChIKey | PPZGQIGMWTWFQM-UHFFFAOYSA-N |
| XLogP | 20.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1368.41 |
| LogP ≤ 5 | 20.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|