C45H3Cl33 — CID 15145965
1,3,5-tris[bis(2,3,4,5,6-pentachlorophenyl)methyl]-2,4,6-trichlorobenzene (PubChem CID 15145965) has the molecular formula C45H3Cl33 and a molecular weight of 1713.47 g/mol. Its IUPAC name is 1,3,5-tris[bis(2,3,4,5,6-pentachlorophenyl)methyl]-2,4,6-trichlorobenzene.
| Compound Name | 1,3,5-tris[bis(2,3,4,5,6-pentachlorophenyl)methyl]-2,4,6-trichlorobenzene |
|---|---|
| PubChem CID | 15145965 |
| Molecular Formula | C45H3Cl33 |
| Molecular Weight | 1713.47 g/mol |
| Exact Mass | 1697.00 |
| IUPAC Name | 1,3,5-tris[bis(2,3,4,5,6-pentachlorophenyl)methyl]-2,4,6-trichlorobenzene |
| SMILES | Clc1c(Cl)c(Cl)c(C(c2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)c2c(Cl)c(C(c3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)c3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)c(Cl)c(C(c3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)c3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)c2Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C45H3Cl33/c46-13-4(1(7-16(49)28(61)40(73)29(62)17(7)50)8-18(51)30(63)41(74)31(64)19(8)52)14(47)6(3(11-24(57)36(69)44(77)37(70)25(11)58)12-26(59)38(71)45(78)39(72)27(12)60)15(48)5(13)2(9-20(53)32(65)42(75)33(66)21(9)54)10-22(55)34(67)43(76)35(68)23(10)56/h1-3H |
| InChIKey | HFYLGQHBZRUGLW-UHFFFAOYSA-N |
| XLogP | 32.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1713.47 |
| LogP ≤ 5 | 32.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|