C10H7Cl2NO3 — CID 142507939
4,7-dichloro-2-hydroxy-5,6-dimethylisoindole-1,3-dione (PubChem CID 142507939) has the molecular formula C10H7Cl2NO3 and a molecular weight of 260.08 g/mol. Its IUPAC name is 4,7-dichloro-2-hydroxy-5,6-dimethylisoindole-1,3-dione.
| Compound Name | 4,7-dichloro-2-hydroxy-5,6-dimethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 142507939 |
| Molecular Formula | C10H7Cl2NO3 |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 4,7-dichloro-2-hydroxy-5,6-dimethylisoindole-1,3-dione |
| SMILES | Cc1c(C)c(Cl)c2c(c1Cl)C(=O)N(O)C2=O |
| InChI | InChI=1S/C10H7Cl2NO3/c1-3-4(2)8(12)6-5(7(3)11)9(14)13(16)10(6)15/h16H,1-2H3 |
| InChIKey | YSQWYBOBARRELM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|