C7H7BCl2O3 — CID 57497288
(2,6-dichloro-3-methoxyphenyl)boronic acid (PubChem CID 57497288) has the molecular formula C7H7BCl2O3 and a molecular weight of 220.85 g/mol. Its IUPAC name is (2,6-dichloro-3-methoxyphenyl)boronic acid.
| Compound Name | (2,6-dichloro-3-methoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 57497288 |
| Molecular Formula | C7H7BCl2O3 |
| Molecular Weight | 220.85 g/mol |
| Exact Mass | 219.99 |
| IUPAC Name | (2,6-dichloro-3-methoxyphenyl)boronic acid |
| SMILES | COc1ccc(Cl)c(B(O)O)c1Cl |
| InChI | InChI=1S/C7H7BCl2O3/c1-13-5-3-2-4(9)6(7(5)10)8(11)12/h2-3,11-12H,1H3 |
| InChIKey | YSIVMUOSCRYSHE-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.85 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|