C8H8Cl2O2 — CID 130133361
(2,3-dichloro-6-methoxyphenyl)methanol (PubChem CID 130133361) has the molecular formula C8H8Cl2O2 and a molecular weight of 207.06 g/mol. Its IUPAC name is (2,3-dichloro-6-methoxyphenyl)methanol.
| Compound Name | (2,3-dichloro-6-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 130133361 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | (2,3-dichloro-6-methoxyphenyl)methanol |
| SMILES | COc1ccc(Cl)c(Cl)c1CO |
| InChI | InChI=1S/C8H8Cl2O2/c1-12-7-3-2-6(9)8(10)5(7)4-11/h2-3,11H,4H2,1H3 |
| InChIKey | OMONSTSEXILJCC-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |