C8H9BCl2O3 — CID 171367474
(2,6-dichloro-3-ethoxyphenyl)boronic acid (PubChem CID 171367474) has the molecular formula C8H9BCl2O3 and a molecular weight of 234.87 g/mol. Its IUPAC name is (2,6-dichloro-3-ethoxyphenyl)boronic acid.
| Compound Name | (2,6-dichloro-3-ethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 171367474 |
| Molecular Formula | C8H9BCl2O3 |
| Molecular Weight | 234.87 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | (2,6-dichloro-3-ethoxyphenyl)boronic acid |
| SMILES | CCOc1ccc(Cl)c(B(O)O)c1Cl |
| InChI | InChI=1S/C8H9BCl2O3/c1-2-14-6-4-3-5(10)7(8(6)11)9(12)13/h3-4,12-13H,2H2,1H3 |
| InChIKey | SVMPIWIFHRHONO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.87 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|