C8H7Cl2IO — CID 171008192
1,3-dichloro-4-ethoxy-2-iodobenzene (PubChem CID 171008192) has the molecular formula C8H7Cl2IO and a molecular weight of 316.95 g/mol. Its IUPAC name is 1,3-dichloro-4-ethoxy-2-iodobenzene.
| Compound Name | 1,3-dichloro-4-ethoxy-2-iodobenzene |
|---|---|
| PubChem CID | 171008192 |
| Molecular Formula | C8H7Cl2IO |
| Molecular Weight | 316.95 g/mol |
| Exact Mass | 315.89 |
| IUPAC Name | 1,3-dichloro-4-ethoxy-2-iodobenzene |
| SMILES | CCOc1ccc(Cl)c(I)c1Cl |
| InChI | InChI=1S/C8H7Cl2IO/c1-2-12-6-4-3-5(9)8(11)7(6)10/h3-4H,2H2,1H3 |
| InChIKey | YBJXFEPSCAIWMW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.95 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|