C24H18BCl9O3 — CID 87743788
tris(2,3,6-trichloro-5-ethoxyphenyl)borane (PubChem CID 87743788) has the molecular formula C24H18BCl9O3 and a molecular weight of 684.29 g/mol. Its IUPAC name is tris(2,3,6-trichloro-5-ethoxyphenyl)borane.
| Compound Name | tris(2,3,6-trichloro-5-ethoxyphenyl)borane |
|---|---|
| PubChem CID | 87743788 |
| Molecular Formula | C24H18BCl9O3 |
| Molecular Weight | 684.29 g/mol |
| Exact Mass | 679.85 |
| IUPAC Name | tris(2,3,6-trichloro-5-ethoxyphenyl)borane |
| SMILES | CCOc1cc(Cl)c(Cl)c(B(c2c(Cl)c(Cl)cc(OCC)c2Cl)c2c(Cl)c(Cl)cc(OCC)c2Cl)c1Cl |
| InChI | InChI=1S/C24H18BCl9O3/c1-4-35-13-7-10(26)19(29)16(22(13)32)25(17-20(30)11(27)8-14(23(17)33)36-5-2)18-21(31)12(28)9-15(24(18)34)37-6-3/h7-9H,4-6H2,1-3H3 |
| InChIKey | NABAIHWKBOENNE-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.29 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|