C36H12B2F18 — CID 159623695
tris(3,4,5-trifluorophenyl)borane (PubChem CID 159623695) has the molecular formula C36H12B2F18 and a molecular weight of 808.08 g/mol. Its IUPAC name is tris(3,4,5-trifluorophenyl)borane.
| Compound Name | tris(3,4,5-trifluorophenyl)borane |
|---|---|
| PubChem CID | 159623695 |
| Molecular Formula | C36H12B2F18 |
| Molecular Weight | 808.08 g/mol |
| Exact Mass | 808.08 |
| IUPAC Name | tris(3,4,5-trifluorophenyl)borane |
| SMILES | Fc1cc(B(c2cc(F)c(F)c(F)c2)c2cc(F)c(F)c(F)c2)cc(F)c1F.Fc1cc(B(c2cc(F)c(F)c(F)c2)c2cc(F)c(F)c(F)c2)cc(F)c1F |
| InChI | InChI=1S/2C18H6BF9/c2*20-10-1-7(2-11(21)16(10)26)19(8-3-12(22)17(27)13(23)4-8)9-5-14(24)18(28)15(25)6-9/h2*1-6H |
| InChIKey | MOFIHTBCRKPBFT-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.08 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|