C30H4B2F20 — CID 101442216
[2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4-difluorophenyl]-(2,3,4,5,6-pentafluorophenyl)-(2,3,4-trifluorophenyl)borane (PubChem CID 101442216) has the molecular formula C30H4B2F20 and a molecular weight of 765.95 g/mol. Its IUPAC name is [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4-difluorophenyl]-(2,3,4,5,6-pentafluorophenyl)-(2,3,4-trifluorophenyl)borane.
| Compound Name | [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4-difluorophenyl]-(2,3,4,5,6-pentafluorophenyl)-(2,3,4-trifluorophenyl)borane |
|---|---|
| PubChem CID | 101442216 |
| Molecular Formula | C30H4B2F20 |
| Molecular Weight | 765.95 g/mol |
| Exact Mass | 766.02 |
| IUPAC Name | [2-bis(2,3,4,5,6-pentafluorophenyl)boranyl-3,4-difluorophenyl]-(2,3,4,5,6-pentafluorophenyl)-(2,3,4-trifluorophenyl)borane |
| SMILES | Fc1ccc(B(c2ccc(F)c(F)c2B(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C30H4B2F20/c33-7-3-1-5(31(6-2-4-8(34)15(37)13(6)35)10-16(38)22(44)28(50)23(45)17(10)39)9(14(7)36)32(11-18(40)24(46)29(51)25(47)19(11)41)12-20(42)26(48)30(52)27(49)21(12)43/h1-4H |
| InChIKey | FENVAMCJZVIFNM-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.95 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|