C26H3BF16 — CID 141052357
(3,4-difluorophenyl)-bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)borane (PubChem CID 141052357) has the molecular formula C26H3BF16 and a molecular weight of 630.09 g/mol. Its IUPAC name is (3,4-difluorophenyl)-bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)borane.
| Compound Name | (3,4-difluorophenyl)-bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)borane |
|---|---|
| PubChem CID | 141052357 |
| Molecular Formula | C26H3BF16 |
| Molecular Weight | 630.09 g/mol |
| Exact Mass | 630.01 |
| IUPAC Name | (3,4-difluorophenyl)-bis(2,3,4,5,6,7,8-heptafluoronaphthalen-1-yl)borane |
| SMILES | Fc1ccc(B(c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)c2c(F)c(F)c(F)c3c(F)c(F)c(F)c(F)c23)cc1F |
| InChI | InChI=1S/C26H3BF16/c28-5-2-1-4(3-6(5)29)27(11-7-9(15(32)21(38)19(11)36)17(34)25(42)23(40)13(7)30)12-8-10(16(33)22(39)20(12)37)18(35)26(43)24(41)14(8)31/h1-3H |
| InChIKey | CHZDEUNQHFKRLU-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.09 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|