C7H5F2K — CID 162451456
potassium 1,2-difluoro-4-methanidylbenzene (PubChem CID 162451456) has the molecular formula C7H5F2K and a molecular weight of 166.21 g/mol. Its IUPAC name is potassium 1,2-difluoro-4-methanidylbenzene.
| Compound Name | potassium 1,2-difluoro-4-methanidylbenzene |
|---|---|
| PubChem CID | 162451456 |
| Molecular Formula | C7H5F2K |
| Molecular Weight | 166.21 g/mol |
| Exact Mass | 166.00 |
| IUPAC Name | potassium 1,2-difluoro-4-methanidylbenzene |
| SMILES | [CH2-]c1ccc(F)c(F)c1.[K+] |
| InChI | InChI=1S/C7H5F2.K/c1-5-2-3-6(8)7(9)4-5;/h2-4H,1H2;/q-1;+1 |
| InChIKey | NDVBCHHOSXZYCG-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.21 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|