C7H5BF5K — CID 82924814
potassium (3,4-difluorophenyl)methyl-trifluoroboranuide (PubChem CID 82924814) has the molecular formula C7H5BF5K and a molecular weight of 234.02 g/mol. Its IUPAC name is potassium (3,4-difluorophenyl)methyl-trifluoroboranuide.
| Compound Name | potassium (3,4-difluorophenyl)methyl-trifluoroboranuide |
|---|---|
| PubChem CID | 82924814 |
| Molecular Formula | C7H5BF5K |
| Molecular Weight | 234.02 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | potassium (3,4-difluorophenyl)methyl-trifluoroboranuide |
| SMILES | Fc1ccc(C[B-](F)(F)F)cc1F.[K+] |
| InChI | InChI=1S/C7H5BF5.K/c9-6-2-1-5(3-7(6)10)4-8(11,12)13;/h1-3H,4H2;/q-1;+1 |
| InChIKey | VXSISNWMCYIWFN-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.02 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|