C7H5Cl2F2N — CID 102529861
N,N-dichloro-1-(3,4-difluorophenyl)methanamine (PubChem CID 102529861) has the molecular formula C7H5Cl2F2N and a molecular weight of 212.03 g/mol. Its IUPAC name is N,N-dichloro-1-(3,4-difluorophenyl)methanamine.
| Compound Name | N,N-dichloro-1-(3,4-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 102529861 |
| Molecular Formula | C7H5Cl2F2N |
| Molecular Weight | 212.03 g/mol |
| Exact Mass | 210.98 |
| IUPAC Name | N,N-dichloro-1-(3,4-difluorophenyl)methanamine |
| SMILES | Fc1ccc(CN(Cl)Cl)cc1F |
| InChI | InChI=1S/C7H5Cl2F2N/c8-12(9)4-5-1-2-6(10)7(11)3-5/h1-3H,4H2 |
| InChIKey | YNVOCKGWUFRMCU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.03 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|