C11H14ClF2N — CID 104555121
1-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropan-2-amine (PubChem CID 104555121) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is 1-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropan-2-amine.
| Compound Name | 1-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropan-2-amine |
|---|---|
| PubChem CID | 104555121 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-chloro-N-[(3,4-difluorophenyl)methyl]-N-methylpropan-2-amine |
| SMILES | CC(CCl)N(C)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H14ClF2N/c1-8(6-12)15(2)7-9-3-4-10(13)11(14)5-9/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | VKUOSFXJXFJYEX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|