C10H12BrF2N — CID 82925317
2-bromo-N-[(3,4-difluorophenyl)methyl]-N-methylethanamine (PubChem CID 82925317) has the molecular formula C10H12BrF2N and a molecular weight of 264.11 g/mol. Its IUPAC name is 2-bromo-N-[(3,4-difluorophenyl)methyl]-N-methylethanamine.
| Compound Name | 2-bromo-N-[(3,4-difluorophenyl)methyl]-N-methylethanamine |
|---|---|
| PubChem CID | 82925317 |
| Molecular Formula | C10H12BrF2N |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 2-bromo-N-[(3,4-difluorophenyl)methyl]-N-methylethanamine |
| SMILES | CN(CCBr)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H12BrF2N/c1-14(5-4-11)7-8-2-3-9(12)10(13)6-8/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | RMPBUTXSIQECCC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|