C9H9F3O2 — CID 117294409
3,4,6-trifluoro-2-(2-hydroxypropan-2-yl)phenol (PubChem CID 117294409) has the molecular formula C9H9F3O2 and a molecular weight of 206.16 g/mol. Its IUPAC name is 3,4,6-trifluoro-2-(2-hydroxypropan-2-yl)phenol.
| Compound Name | 3,4,6-trifluoro-2-(2-hydroxypropan-2-yl)phenol |
|---|---|
| PubChem CID | 117294409 |
| Molecular Formula | C9H9F3O2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.06 |
| IUPAC Name | 3,4,6-trifluoro-2-(2-hydroxypropan-2-yl)phenol |
| SMILES | CC(C)(O)c1c(O)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H9F3O2/c1-9(2,14)6-7(12)4(10)3-5(11)8(6)13/h3,13-14H,1-2H3 |
| InChIKey | UXRVPHXMKKSCEX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|