About 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol
4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol (PubChem CID 117307825) has the molecular formula C10H13FO4
and a molecular weight of 216.21 g/mol. Its IUPAC name is 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol.
Molecular Properties
| Compound Name | 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol |
| PubChem CID | 117307825 |
| Molecular Formula | C10H13FO4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol |
| SMILES | COc1cc(O)c(O)c(C(C)(C)O)c1F |
| InChI | InChI=1S/C10H13FO4/c1-10(2,14)7-8(11)6(15-3)4-5(12)9(7)13/h4,12-14H,1-3H3 |
| InChIKey | XNZAPBSFYUQIAI-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol?
The IUPAC name of 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol (CID 117307825) is 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol.
What is the SMILES notation for 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol?
The canonical SMILES for 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol is COc1cc(O)c(O)c(C(C)(C)O)c1F.
What is the InChIKey of 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol?
The InChIKey is XNZAPBSFYUQIAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FO4/c1-10(2,14)7-8(11)6(15-3)4-5(12)9(7)13/h4,12-14H,1-3H3.
What are the key properties of 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol?
4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol has a molecular weight of 216.21 g/mol, XLogP of 1.47, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-(2-hydroxypropan-2-yl)-5-methoxybenzene-1,2-diol is sourced from PubChem (CID 117307825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).