C9H11FO2 — CID 10607234
2-fluoro-5-methoxy-3,4-dimethylphenol (PubChem CID 10607234) has the molecular formula C9H11FO2 and a molecular weight of 170.18 g/mol. Its IUPAC name is 2-fluoro-5-methoxy-3,4-dimethylphenol.
| Compound Name | 2-fluoro-5-methoxy-3,4-dimethylphenol |
|---|---|
| PubChem CID | 10607234 |
| Molecular Formula | C9H11FO2 |
| Molecular Weight | 170.18 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-fluoro-5-methoxy-3,4-dimethylphenol |
| SMILES | COc1cc(O)c(F)c(C)c1C |
| InChI | InChI=1S/C9H11FO2/c1-5-6(2)9(10)7(11)4-8(5)12-3/h4,11H,1-3H3 |
| InChIKey | JIIGCUYVHDMHLY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.18 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |