C8H12F3N — CID 145314884
ethane;molecular hydrogen;2,3,5-trifluoroaniline (PubChem CID 145314884) has the molecular formula C8H12F3N and a molecular weight of 179.19 g/mol. Its IUPAC name is ethane;molecular hydrogen;2,3,5-trifluoroaniline.
| Compound Name | ethane;molecular hydrogen;2,3,5-trifluoroaniline |
|---|---|
| PubChem CID | 145314884 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | ethane;molecular hydrogen;2,3,5-trifluoroaniline |
| SMILES | CC.Nc1cc(F)cc(F)c1F.[H][H] |
| InChI | InChI=1S/C6H4F3N.C2H6.H2/c7-3-1-4(8)6(9)5(10)2-3;1-2;/h1-2H,10H2;1-2H3;1H |
| InChIKey | IQORVNNTHDGVJP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|