(3-amino-4,5-difluorophenyl)boronic acid

C6H6BF2NO2 — CID 44754741

IUPAC(3-amino-4,5-difluorophenyl)boronic acid
SMILESNc1cc(B(O)O)cc(F)c1F
InChIInChI=1S/C6H6BF2NO2/c8-4-1-3(7(11)12)2-5(10)6(4)9/h1-2,11-12H,10H2
InChIKeyKPRHAVKMMVFSJB-UHFFFAOYSA-N
MW172.93 g/mol
LogP-0.77
Rot. Bonds1

About (3-amino-4,5-difluorophenyl)boronic acid

(3-amino-4,5-difluorophenyl)boronic acid (PubChem CID 44754741) has the molecular formula C6H6BF2NO2 and a molecular weight of 172.93 g/mol. Its IUPAC name is (3-amino-4,5-difluorophenyl)boronic acid.

Molecular Properties

Compound Name(3-amino-4,5-difluorophenyl)boronic acid
PubChem CID44754741
Molecular FormulaC6H6BF2NO2
Molecular Weight172.93 g/mol
Exact Mass173.05
IUPAC Name(3-amino-4,5-difluorophenyl)boronic acid
SMILESNc1cc(B(O)O)cc(F)c1F
InChIInChI=1S/C6H6BF2NO2/c8-4-1-3(7(11)12)2-5(10)6(4)9/h1-2,11-12H,10H2
InChIKeyKPRHAVKMMVFSJB-UHFFFAOYSA-N
XLogP-0.77
TPSA66.48 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.93
LogP ≤ 5-0.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-amino-4,5-difluorophenyl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(3,4-difluoro-5-pyrrolidin-1-ylphenyl)boronic acid
CID 91759142
(6-amino-5-fluoro-3-pyridinyl)boronic acid
CID 91882688
4-borono-2,6-difluorobenzoic acid
CID 57497263
(3,5-dibromo-4-fluorophenyl)boronic acid
CID 130750090
tris(3,4,5-trifluorophenyl)borane
CID 159623695
ethane;molecular hydrogen;2,3,5-trifluoroaniline
CID 145314884
[3,5-diamino-4-(2-methylpropyl)phenyl]boronic acid
CID 163201392
(3,4-diethoxy-5-fluorophenyl)boronic acid
CID 164894924
(3-bromo-2,4,5-trifluorophenyl)boronic acid
CID 154814175
(3,5-ditert-butyl-4-fluorophenyl)boronic acid
CID 70872894
6-amino-2,3,4-trifluorophenol
CID 19957203
boric acid;1,2,3,4,5-pentafluorobenzene;silver
CID 159886582

Frequently Asked Questions

What is the IUPAC name of (3-amino-4,5-difluorophenyl)boronic acid?
The IUPAC name of (3-amino-4,5-difluorophenyl)boronic acid (CID 44754741) is (3-amino-4,5-difluorophenyl)boronic acid.
What is the SMILES notation for (3-amino-4,5-difluorophenyl)boronic acid?
The canonical SMILES for (3-amino-4,5-difluorophenyl)boronic acid is Nc1cc(B(O)O)cc(F)c1F.
What is the InChIKey of (3-amino-4,5-difluorophenyl)boronic acid?
The InChIKey is KPRHAVKMMVFSJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BF2NO2/c8-4-1-3(7(11)12)2-5(10)6(4)9/h1-2,11-12H,10H2.
What are the key properties of (3-amino-4,5-difluorophenyl)boronic acid?
(3-amino-4,5-difluorophenyl)boronic acid has a molecular weight of 172.93 g/mol, XLogP of -0.77, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-4,5-difluorophenyl)boronic acid is sourced from PubChem (CID 44754741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).