C10H14BFO4 — CID 164894924
(3,4-diethoxy-5-fluorophenyl)boronic acid (PubChem CID 164894924) has the molecular formula C10H14BFO4 and a molecular weight of 228.03 g/mol. Its IUPAC name is (3,4-diethoxy-5-fluorophenyl)boronic acid.
| Compound Name | (3,4-diethoxy-5-fluorophenyl)boronic acid |
|---|---|
| PubChem CID | 164894924 |
| Molecular Formula | C10H14BFO4 |
| Molecular Weight | 228.03 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (3,4-diethoxy-5-fluorophenyl)boronic acid |
| SMILES | CCOc1cc(B(O)O)cc(F)c1OCC |
| InChI | InChI=1S/C10H14BFO4/c1-3-15-9-6-7(11(13)14)5-8(12)10(9)16-4-2/h5-6,13-14H,3-4H2,1-2H3 |
| InChIKey | FJYOLNXGTXLNCT-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.03 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|