C10H12BF2NO2 — CID 91759142
(3,4-difluoro-5-pyrrolidin-1-ylphenyl)boronic acid (PubChem CID 91759142) has the molecular formula C10H12BF2NO2 and a molecular weight of 227.02 g/mol. Its IUPAC name is (3,4-difluoro-5-pyrrolidin-1-ylphenyl)boronic acid.
| Compound Name | (3,4-difluoro-5-pyrrolidin-1-ylphenyl)boronic acid |
|---|---|
| PubChem CID | 91759142 |
| Molecular Formula | C10H12BF2NO2 |
| Molecular Weight | 227.02 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (3,4-difluoro-5-pyrrolidin-1-ylphenyl)boronic acid |
| SMILES | OB(O)c1cc(F)c(F)c(N2CCCC2)c1 |
| InChI | InChI=1S/C10H12BF2NO2/c12-8-5-7(11(15)16)6-9(10(8)13)14-3-1-2-4-14/h5-6,15-16H,1-4H2 |
| InChIKey | DTYDZPRAFWUWJO-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.02 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|