C13H6BrF4NO — CID 107123714
(3-amino-2,5-difluorophenyl)-(4-bromo-2,5-difluorophenyl)methanone (PubChem CID 107123714) has the molecular formula C13H6BrF4NO and a molecular weight of 348.09 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(4-bromo-2,5-difluorophenyl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(4-bromo-2,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 107123714 |
| Molecular Formula | C13H6BrF4NO |
| Molecular Weight | 348.09 g/mol |
| Exact Mass | 346.96 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(4-bromo-2,5-difluorophenyl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)c2cc(F)c(Br)cc2F)c1F |
| InChI | InChI=1S/C13H6BrF4NO/c14-8-4-9(16)6(3-10(8)17)13(20)7-1-5(15)2-11(19)12(7)18/h1-4H,19H2 |
| InChIKey | WYUQTKWWLISHJR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|