C14H9Cl2F2NO2 — CID 107123750
(3-amino-2,5-difluorophenyl)-(2,5-dichloro-4-methoxyphenyl)methanone (PubChem CID 107123750) has the molecular formula C14H9Cl2F2NO2 and a molecular weight of 332.13 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(2,5-dichloro-4-methoxyphenyl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(2,5-dichloro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 107123750 |
| Molecular Formula | C14H9Cl2F2NO2 |
| Molecular Weight | 332.13 g/mol |
| Exact Mass | 331.00 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(2,5-dichloro-4-methoxyphenyl)methanone |
| SMILES | COc1cc(Cl)c(C(=O)c2cc(F)cc(N)c2F)cc1Cl |
| InChI | InChI=1S/C14H9Cl2F2NO2/c1-21-12-5-9(15)7(4-10(12)16)14(20)8-2-6(17)3-11(19)13(8)18/h2-5H,19H2,1H3 |
| InChIKey | VNGHNXLEUFOVKW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|