C10H5Cl2F5O2 — CID 114038014
1-(2,5-dichloro-4-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one (PubChem CID 114038014) has the molecular formula C10H5Cl2F5O2 and a molecular weight of 323.04 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one.
| Compound Name | 1-(2,5-dichloro-4-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one |
|---|---|
| PubChem CID | 114038014 |
| Molecular Formula | C10H5Cl2F5O2 |
| Molecular Weight | 323.04 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)-2,2,3,3,3-pentafluoropropan-1-one |
| SMILES | COc1cc(Cl)c(C(=O)C(F)(F)C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C10H5Cl2F5O2/c1-19-7-3-5(11)4(2-6(7)12)8(18)9(13,14)10(15,16)17/h2-3H,1H3 |
| InChIKey | ACXQJMNNBYHXOV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.04 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|