C15H13Cl2NO3 — CID 104785092
(4-amino-3-methoxyphenyl)-(2,5-dichloro-4-methoxyphenyl)methanone (PubChem CID 104785092) has the molecular formula C15H13Cl2NO3 and a molecular weight of 326.18 g/mol. Its IUPAC name is (4-amino-3-methoxyphenyl)-(2,5-dichloro-4-methoxyphenyl)methanone.
| Compound Name | (4-amino-3-methoxyphenyl)-(2,5-dichloro-4-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 104785092 |
| Molecular Formula | C15H13Cl2NO3 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | (4-amino-3-methoxyphenyl)-(2,5-dichloro-4-methoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2cc(Cl)c(OC)cc2Cl)ccc1N |
| InChI | InChI=1S/C15H13Cl2NO3/c1-20-13-7-10(16)9(6-11(13)17)15(19)8-3-4-12(18)14(5-8)21-2/h3-7H,18H2,1-2H3 |
| InChIKey | URGVWLGWEAXRGP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|