C15H8BrF2NOS — CID 107123742
(3-amino-2,5-difluorophenyl)-(7-bromo-1-benzothiophen-3-yl)methanone (PubChem CID 107123742) has the molecular formula C15H8BrF2NOS and a molecular weight of 368.20 g/mol. Its IUPAC name is (3-amino-2,5-difluorophenyl)-(7-bromo-1-benzothiophen-3-yl)methanone.
| Compound Name | (3-amino-2,5-difluorophenyl)-(7-bromo-1-benzothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 107123742 |
| Molecular Formula | C15H8BrF2NOS |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 366.95 |
| IUPAC Name | (3-amino-2,5-difluorophenyl)-(7-bromo-1-benzothiophen-3-yl)methanone |
| SMILES | Nc1cc(F)cc(C(=O)c2csc3c(Br)cccc23)c1F |
| InChI | InChI=1S/C15H8BrF2NOS/c16-11-3-1-2-8-10(6-21-15(8)11)14(20)9-4-7(17)5-12(19)13(9)18/h1-6H,19H2 |
| InChIKey | YQRVDMDFXLNBJC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|