C15H11BrN2OS — CID 81148188
(7-bromo-1-benzothiophen-3-yl)-(2,4-diaminophenyl)methanone (PubChem CID 81148188) has the molecular formula C15H11BrN2OS and a molecular weight of 347.24 g/mol. Its IUPAC name is (7-bromo-1-benzothiophen-3-yl)-(2,4-diaminophenyl)methanone.
| Compound Name | (7-bromo-1-benzothiophen-3-yl)-(2,4-diaminophenyl)methanone |
|---|---|
| PubChem CID | 81148188 |
| Molecular Formula | C15H11BrN2OS |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | (7-bromo-1-benzothiophen-3-yl)-(2,4-diaminophenyl)methanone |
| SMILES | Nc1ccc(C(=O)c2csc3c(Br)cccc23)c(N)c1 |
| InChI | InChI=1S/C15H11BrN2OS/c16-12-3-1-2-9-11(7-20-15(9)12)14(19)10-5-4-8(17)6-13(10)18/h1-7H,17-18H2 |
| InChIKey | RKMYOKFXSMNTJK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|