C13H7F4N3 — CID 107644839
2-methyl-6-(2,3,5,6-tetrafluoroanilino)pyridine-4-carbonitrile (PubChem CID 107644839) has the molecular formula C13H7F4N3 and a molecular weight of 281.21 g/mol. Its IUPAC name is 2-methyl-6-(2,3,5,6-tetrafluoroanilino)pyridine-4-carbonitrile.
| Compound Name | 2-methyl-6-(2,3,5,6-tetrafluoroanilino)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 107644839 |
| Molecular Formula | C13H7F4N3 |
| Molecular Weight | 281.21 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 2-methyl-6-(2,3,5,6-tetrafluoroanilino)pyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(Nc2c(F)c(F)cc(F)c2F)n1 |
| InChI | InChI=1S/C13H7F4N3/c1-6-2-7(5-18)3-10(19-6)20-13-11(16)8(14)4-9(15)12(13)17/h2-4H,1H3,(H,19,20) |
| InChIKey | BLZMDESIMUIPPA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.21 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|