C14H12IN3 — CID 114257428
2-(5-iodo-2-methylanilino)-6-methylpyridine-4-carbonitrile (PubChem CID 114257428) has the molecular formula C14H12IN3 and a molecular weight of 349.18 g/mol. Its IUPAC name is 2-(5-iodo-2-methylanilino)-6-methylpyridine-4-carbonitrile.
| Compound Name | 2-(5-iodo-2-methylanilino)-6-methylpyridine-4-carbonitrile |
|---|---|
| PubChem CID | 114257428 |
| Molecular Formula | C14H12IN3 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 2-(5-iodo-2-methylanilino)-6-methylpyridine-4-carbonitrile |
| SMILES | Cc1cc(C#N)cc(Nc2cc(I)ccc2C)n1 |
| InChI | InChI=1S/C14H12IN3/c1-9-3-4-12(15)7-13(9)18-14-6-11(8-16)5-10(2)17-14/h3-7H,1-2H3,(H,17,18) |
| InChIKey | PCZMRVVQMSIHHO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|