C12H14IN5 — CID 114258171
4-N-(5-iodo-2-methylphenyl)-6-N-methylpyrimidine-2,4,6-triamine (PubChem CID 114258171) has the molecular formula C12H14IN5 and a molecular weight of 355.18 g/mol. Its IUPAC name is 4-N-(5-iodo-2-methylphenyl)-6-N-methylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(5-iodo-2-methylphenyl)-6-N-methylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 114258171 |
| Molecular Formula | C12H14IN5 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-N-(5-iodo-2-methylphenyl)-6-N-methylpyrimidine-2,4,6-triamine |
| SMILES | CNc1cc(Nc2cc(I)ccc2C)nc(N)n1 |
| InChI | InChI=1S/C12H14IN5/c1-7-3-4-8(13)5-9(7)16-11-6-10(15-2)17-12(14)18-11/h3-6H,1-2H3,(H4,14,15,16,17,18) |
| InChIKey | OWJTUWLQTSHDHZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|