C10H10IN5 — CID 2730318
2-N-(5-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 2730318) has the molecular formula C10H10IN5 and a molecular weight of 327.13 g/mol. Its IUPAC name is 2-N-(5-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(5-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2730318 |
| Molecular Formula | C10H10IN5 |
| Molecular Weight | 327.13 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2-N-(5-iodo-2-methylphenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1ccc(I)cc1Nc1ncnc(N)n1 |
| InChI | InChI=1S/C10H10IN5/c1-6-2-3-7(11)4-8(6)15-10-14-5-13-9(12)16-10/h2-5H,1H3,(H3,12,13,14,15,16) |
| InChIKey | IJGPKTKFSYYAHA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.13 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|