C9H7F2N5 — CID 2782901
2-N-(2,4-difluorophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 2782901) has the molecular formula C9H7F2N5 and a molecular weight of 223.19 g/mol. Its IUPAC name is 2-N-(2,4-difluorophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,4-difluorophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 2782901 |
| Molecular Formula | C9H7F2N5 |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.07 |
| IUPAC Name | 2-N-(2,4-difluorophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C9H7F2N5/c10-5-1-2-7(6(11)3-5)15-9-14-4-13-8(12)16-9/h1-4H,(H3,12,13,14,15,16) |
| InChIKey | PGZOEGOIYNTJCI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |