C13H16F2N6 — CID 80738160
4-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 80738160) has the molecular formula C13H16F2N6 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 80738160 |
| Molecular Formula | C13H16F2N6 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 4-N-(2,4-difluorophenyl)-2-N,2-N-diethyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCN(CC)c1nc(N)nc(Nc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C13H16F2N6/c1-3-21(4-2)13-19-11(16)18-12(20-13)17-10-6-5-8(14)7-9(10)15/h5-7H,3-4H2,1-2H3,(H3,16,17,18,19,20) |
| InChIKey | LTRRLXPJCYLPNR-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |