C10H9F2N5 — CID 112746178
2-N-[(2,4-difluorophenyl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 112746178) has the molecular formula C10H9F2N5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 2-N-[(2,4-difluorophenyl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[(2,4-difluorophenyl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 112746178 |
| Molecular Formula | C10H9F2N5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-N-[(2,4-difluorophenyl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1ncnc(NCc2ccc(F)cc2F)n1 |
| InChI | InChI=1S/C10H9F2N5/c11-7-2-1-6(8(12)3-7)4-14-10-16-5-15-9(13)17-10/h1-3,5H,4H2,(H3,13,14,15,16,17) |
| InChIKey | DRGQYKWAZHSCKI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |