C13H17N7O2 — CID 158478502
6-[(4-amino-1,3,5-triazin-2-yl)amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione;molecular hydrogen (PubChem CID 158478502) has the molecular formula C13H17N7O2 and a molecular weight of 303.33 g/mol. Its IUPAC name is 6-[(4-amino-1,3,5-triazin-2-yl)amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione;molecular hydrogen.
| Compound Name | 6-[(4-amino-1,3,5-triazin-2-yl)amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione;molecular hydrogen |
|---|---|
| PubChem CID | 158478502 |
| Molecular Formula | C13H17N7O2 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 6-[(4-amino-1,3,5-triazin-2-yl)amino]-3,3,8-trimethyl-2H-imidazo[1,5-a]pyridine-1,5-dione;molecular hydrogen |
| SMILES | Cc1cc(Nc2ncnc(N)n2)c(=O)n2c1C(=O)NC2(C)C.[H][H] |
| InChI | InChI=1S/C13H15N7O2.H2/c1-6-4-7(17-12-16-5-15-11(14)18-12)10(22)20-8(6)9(21)19-13(20,2)3;/h4-5H,1-3H3,(H,19,21)(H3,14,15,16,17,18);1H |
| InChIKey | HHFSEJUCDGSJCV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 127.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |