C18H18F2N6O2 — CID 167457384
CID 167457384 (PubChem CID 167457384) has the molecular formula C18H18F2N6O2 and a molecular weight of 388.38 g/mol.
| Compound Name | CID 167457384 |
|---|---|
| PubChem CID | 167457384 |
| Molecular Formula | C18H18F2N6O2 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CC2(CC(F)(F)C2)C1 |
| InChI | InChI=1S/C18H18F2N6O2/c1-9-2-10(24-12-3-11(21)22-8-23-12)15(28)26-13(9)14(27)25-18(26)6-16(7-18)4-17(19,20)5-16/h2-3,8H,4-7H2,1H3,(H,25,27)(H3,21,22,23,24) |
| InChIKey | INFXNBNJSMKZJC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |