C25H30F2N6O3 — CID 166460720
CID 166460720 (PubChem CID 166460720) has the molecular formula C25H30F2N6O3 and a molecular weight of 500.55 g/mol.
| Compound Name | CID 166460720 |
|---|---|
| PubChem CID | 166460720 |
| Molecular Formula | C25H30F2N6O3 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.23 |
| IUPAC Name | — |
| SMILES | CC.Cc1cc(Nc2cc(NC(=O)C3CC3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC1)CC2(F)F |
| InChI | InChI=1S/C23H24F2N6O3.C2H6/c1-12-8-14(28-15-9-16(27-11-26-15)29-18(32)13-2-3-13)20(34)31-17(12)19(33)30-22(31)6-4-21(5-7-22)10-23(21,24)25;1-2/h8-9,11,13H,2-7,10H2,1H3,(H,30,33)(H2,26,27,28,29,32);1-2H3 |
| InChIKey | QJUMTRABFJZYBC-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 118.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |