C30H31N7O5 — CID 172572700
CID 172572700 (PubChem CID 172572700) has the molecular formula C30H31N7O5 and a molecular weight of 569.62 g/mol.
| Compound Name | CID 172572700 |
|---|---|
| PubChem CID | 172572700 |
| Molecular Formula | C30H31N7O5 |
| Molecular Weight | 569.62 g/mol |
| Exact Mass | 569.24 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(NC(=O)C3CC3)ncn2)c(=O)n2c1C(=O)NC21CCC2(CC1)CN2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C30H31N7O5/c1-18-13-21(33-22-14-23(32-17-31-22)34-25(38)20-7-8-20)27(40)37-24(18)26(39)35-30(37)11-9-29(10-12-30)16-36(29)28(41)42-15-19-5-3-2-4-6-19/h2-6,13-14,17,20H,7-12,15-16H2,1H3,(H,35,39)(H2,31,32,33,34,38) |
| InChIKey | VNZLVSIVCGQRIJ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.62 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|