C19H22N6O2 — CID 167457399
CID 167457399 (PubChem CID 167457399) has the molecular formula C19H22N6O2 and a molecular weight of 366.43 g/mol.
| Compound Name | CID 167457399 |
|---|---|
| PubChem CID | 167457399 |
| Molecular Formula | C19H22N6O2 |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | — |
| SMILES | Cc1cc(Nc2cc(N)ncn2)c(=O)n2c1C(=O)NC21CCC2(CCC2)C1 |
| InChI | InChI=1S/C19H22N6O2/c1-11-7-12(23-14-8-13(20)21-10-22-14)17(27)25-15(11)16(26)24-19(25)6-5-18(9-19)3-2-4-18/h7-8,10H,2-6,9H2,1H3,(H,24,26)(H3,20,21,22,23) |
| InChIKey | DKZJWDRREYQEND-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |